C22H24N4O6 — CID 170881163
3-[7-methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 170881163) has the molecular formula C22H24N4O6 and a molecular weight of 440.46 g/mol. Its IUPAC name is 3-[7-methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-[7-methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 170881163 |
| Molecular Formula | C22H24N4O6 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 3-[7-methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | Cc1ccn2c(CC(NC(=O)OC(C)(C)C)C(=O)O)c(-c3cccc([N+](=O)[O-])c3)nc2c1 |
| InChI | InChI=1S/C22H24N4O6/c1-13-8-9-25-17(12-16(20(27)28)23-21(29)32-22(2,3)4)19(24-18(25)10-13)14-6-5-7-15(11-14)26(30)31/h5-11,16H,12H2,1-4H3,(H,23,29)(H,27,28) |
| InChIKey | UDSPZUUZGHARHF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|