C32H26N4O6 — CID 170882697
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[6-methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]propanoic acid (PubChem CID 170882697) has the molecular formula C32H26N4O6 and a molecular weight of 562.58 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[6-methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]propanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[6-methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 170882697 |
| Molecular Formula | C32H26N4O6 |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[6-methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]propanoic acid |
| SMILES | Cc1ccc2nc(-c3cccc([N+](=O)[O-])c3)c(CC(NC(=O)OCC3c4ccccc4-c4ccccc43)C(=O)O)n2c1 |
| InChI | InChI=1S/C32H26N4O6/c1-19-13-14-29-34-30(20-7-6-8-21(15-20)36(40)41)28(35(29)17-19)16-27(31(37)38)33-32(39)42-18-26-24-11-4-2-9-22(24)23-10-3-5-12-25(23)26/h2-15,17,26-27H,16,18H2,1H3,(H,33,39)(H,37,38) |
| InChIKey | JXXKOEXOMGGYIH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|