C29H34N4O3 — CID 23766584
2-[[2-cyclohex-3-en-1-yl-3-(cyclohexylamino)imidazo[1,2-a]pyridine-7-carbonyl]amino]-3-phenylpropanoic acid (PubChem CID 23766584) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is 2-[[2-cyclohex-3-en-1-yl-3-(cyclohexylamino)imidazo[1,2-a]pyridine-7-carbonyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-cyclohex-3-en-1-yl-3-(cyclohexylamino)imidazo[1,2-a]pyridine-7-carbonyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 23766584 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 2-[[2-cyclohex-3-en-1-yl-3-(cyclohexylamino)imidazo[1,2-a]pyridine-7-carbonyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)O)c1ccn2c(NC3CCCCC3)c(C3CC=CCC3)nc2c1 |
| InChI | InChI=1S/C29H34N4O3/c34-28(31-24(29(35)36)18-20-10-4-1-5-11-20)22-16-17-33-25(19-22)32-26(21-12-6-2-7-13-21)27(33)30-23-14-8-3-9-15-23/h1-2,4-6,10-11,16-17,19,21,23-24,30H,3,7-9,12-15,18H2,(H,31,34)(H,35,36) |
| InChIKey | WOMITKQIBYJFKC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|