C25H19N3O5 — CID 58718090
(2S)-2-(isoquinoline-3-carbonylamino)-3-[4-(3-nitrophenyl)phenyl]propanoic acid (PubChem CID 58718090) has the molecular formula C25H19N3O5 and a molecular weight of 441.44 g/mol. Its IUPAC name is (2S)-2-(isoquinoline-3-carbonylamino)-3-[4-(3-nitrophenyl)phenyl]propanoic acid.
| Compound Name | (2S)-2-(isoquinoline-3-carbonylamino)-3-[4-(3-nitrophenyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 58718090 |
| Molecular Formula | C25H19N3O5 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | (2S)-2-(isoquinoline-3-carbonylamino)-3-[4-(3-nitrophenyl)phenyl]propanoic acid |
| SMILES | O=C(N[C@@H](Cc1ccc(-c2cccc([N+](=O)[O-])c2)cc1)C(=O)O)c1cc2ccccc2cn1 |
| InChI | InChI=1S/C25H19N3O5/c29-24(22-14-19-4-1-2-5-20(19)15-26-22)27-23(25(30)31)12-16-8-10-17(11-9-16)18-6-3-7-21(13-18)28(32)33/h1-11,13-15,23H,12H2,(H,27,29)(H,30,31)/t23-/m0/s1 |
| InChIKey | QLXPVCQJEALPFP-QHCPKHFHSA-N |
| XLogP | 4.24 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|