C18H14FN3O3 — CID 171320846
2-(cinnoline-3-carbonylamino)-3-(4-fluorophenyl)propanoic acid (PubChem CID 171320846) has the molecular formula C18H14FN3O3 and a molecular weight of 339.33 g/mol. Its IUPAC name is 2-(cinnoline-3-carbonylamino)-3-(4-fluorophenyl)propanoic acid.
| Compound Name | 2-(cinnoline-3-carbonylamino)-3-(4-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 171320846 |
| Molecular Formula | C18H14FN3O3 |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 2-(cinnoline-3-carbonylamino)-3-(4-fluorophenyl)propanoic acid |
| SMILES | O=C(NC(Cc1ccc(F)cc1)C(=O)O)c1cc2ccccc2nn1 |
| InChI | InChI=1S/C18H14FN3O3/c19-13-7-5-11(6-8-13)9-16(18(24)25)20-17(23)15-10-12-3-1-2-4-14(12)21-22-15/h1-8,10,16H,9H2,(H,20,23)(H,24,25) |
| InChIKey | DNUCZZDXJLCBNN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |