C20H18N2O5 — CID 167977581
(2S)-3-(4-hydroxyphenyl)-2-[(2-methyl-1-oxoisoquinoline-3-carbonyl)amino]propanoic acid (PubChem CID 167977581) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is (2S)-3-(4-hydroxyphenyl)-2-[(2-methyl-1-oxoisoquinoline-3-carbonyl)amino]propanoic acid.
| Compound Name | (2S)-3-(4-hydroxyphenyl)-2-[(2-methyl-1-oxoisoquinoline-3-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 167977581 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (2S)-3-(4-hydroxyphenyl)-2-[(2-methyl-1-oxoisoquinoline-3-carbonyl)amino]propanoic acid |
| SMILES | Cn1c(C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)O)cc2ccccc2c1=O |
| InChI | InChI=1S/C20H18N2O5/c1-22-17(11-13-4-2-3-5-15(13)19(22)25)18(24)21-16(20(26)27)10-12-6-8-14(23)9-7-12/h2-9,11,16,23H,10H2,1H3,(H,21,24)(H,26,27)/t16-/m0/s1 |
| InChIKey | HAGDQWMATOLLSS-INIZCTEOSA-N |
| XLogP | 1.67 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |