C22H26N6O3 — CID 23793763
N-(2-aminoethyl)-3-(cyclohexylamino)-2-(3-nitrophenyl)imidazo[1,2-a]pyridine-7-carboxamide (PubChem CID 23793763) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-(cyclohexylamino)-2-(3-nitrophenyl)imidazo[1,2-a]pyridine-7-carboxamide.
| Compound Name | N-(2-aminoethyl)-3-(cyclohexylamino)-2-(3-nitrophenyl)imidazo[1,2-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 23793763 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | N-(2-aminoethyl)-3-(cyclohexylamino)-2-(3-nitrophenyl)imidazo[1,2-a]pyridine-7-carboxamide |
| SMILES | NCCNC(=O)c1ccn2c(NC3CCCCC3)c(-c3cccc([N+](=O)[O-])c3)nc2c1 |
| InChI | InChI=1S/C22H26N6O3/c23-10-11-24-22(29)16-9-12-27-19(14-16)26-20(15-5-4-8-18(13-15)28(30)31)21(27)25-17-6-2-1-3-7-17/h4-5,8-9,12-14,17,25H,1-3,6-7,10-11,23H2,(H,24,29) |
| InChIKey | HFVNTOALMKDKND-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|