C30H28N6O3 — CID 23736368
N-[[3-(aminomethyl)phenyl]methyl]-3-(2,6-dimethylanilino)-2-(4-nitrophenyl)imidazo[1,2-a]pyridine-7-carboxamide (PubChem CID 23736368) has the molecular formula C30H28N6O3 and a molecular weight of 520.59 g/mol. Its IUPAC name is N-[[3-(aminomethyl)phenyl]methyl]-3-(2,6-dimethylanilino)-2-(4-nitrophenyl)imidazo[1,2-a]pyridine-7-carboxamide.
| Compound Name | N-[[3-(aminomethyl)phenyl]methyl]-3-(2,6-dimethylanilino)-2-(4-nitrophenyl)imidazo[1,2-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 23736368 |
| Molecular Formula | C30H28N6O3 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | N-[[3-(aminomethyl)phenyl]methyl]-3-(2,6-dimethylanilino)-2-(4-nitrophenyl)imidazo[1,2-a]pyridine-7-carboxamide |
| SMILES | Cc1cccc(C)c1Nc1c(-c2ccc([N+](=O)[O-])cc2)nc2cc(C(=O)NCc3cccc(CN)c3)ccn12 |
| InChI | InChI=1S/C30H28N6O3/c1-19-5-3-6-20(2)27(19)34-29-28(23-9-11-25(12-10-23)36(38)39)33-26-16-24(13-14-35(26)29)30(37)32-18-22-8-4-7-21(15-22)17-31/h3-16,34H,17-18,31H2,1-2H3,(H,32,37) |
| InChIKey | IWDFIJUPYXKYIC-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|