C22H23N5O2 — CID 23821882
N-(2-aminoethyl)-3-(2,6-dimethylanilino)-2-(furan-2-yl)imidazo[1,2-a]pyridine-7-carboxamide (PubChem CID 23821882) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-(2,6-dimethylanilino)-2-(furan-2-yl)imidazo[1,2-a]pyridine-7-carboxamide.
| Compound Name | N-(2-aminoethyl)-3-(2,6-dimethylanilino)-2-(furan-2-yl)imidazo[1,2-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 23821882 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | N-(2-aminoethyl)-3-(2,6-dimethylanilino)-2-(furan-2-yl)imidazo[1,2-a]pyridine-7-carboxamide |
| SMILES | Cc1cccc(C)c1Nc1c(-c2ccco2)nc2cc(C(=O)NCCN)ccn12 |
| InChI | InChI=1S/C22H23N5O2/c1-14-5-3-6-15(2)19(14)26-21-20(17-7-4-12-29-17)25-18-13-16(8-11-27(18)21)22(28)24-10-9-23/h3-8,11-13,26H,9-10,23H2,1-2H3,(H,24,28) |
| InChIKey | XXVRQSVWRWQWJB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_65_C(6)', 'substructure': 'N/A'} |
|---|