C17H14N4O3 — CID 557426
1-(furan-2-ylmethyl)-3-(2-methylphenyl)-7H-purine-2,6-dione (PubChem CID 557426) has the molecular formula C17H14N4O3 and a molecular weight of 322.32 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-(2-methylphenyl)-7H-purine-2,6-dione.
| Compound Name | 1-(furan-2-ylmethyl)-3-(2-methylphenyl)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 557426 |
| Molecular Formula | C17H14N4O3 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-(2-methylphenyl)-7H-purine-2,6-dione |
| SMILES | Cc1ccccc1-n1c(=O)n(Cc2ccco2)c(=O)c2[nH]cnc21 |
| InChI | InChI=1S/C17H14N4O3/c1-11-5-2-3-7-13(11)21-15-14(18-10-19-15)16(22)20(17(21)23)9-12-6-4-8-24-12/h2-8,10H,9H2,1H3,(H,18,19) |
| InChIKey | DGOYBDKTDDCUDD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 85.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |