About 8-(furan-2-yl)-1,3-dimethyl-7H-purine-2,6-dione
8-(furan-2-yl)-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 2816272) has the molecular formula C11H10N4O3
and a molecular weight of 246.23 g/mol. Its IUPAC name is 8-(furan-2-yl)-1,3-dimethyl-7H-purine-2,6-dione.
Molecular Properties
| Compound Name | 8-(furan-2-yl)-1,3-dimethyl-7H-purine-2,6-dione |
| PubChem CID | 2816272 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 8-(furan-2-yl)-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(-c3ccco3)nc2n(C)c1=O |
| InChI | InChI=1S/C11H10N4O3/c1-14-9-7(10(16)15(2)11(14)17)12-8(13-9)6-4-3-5-18-6/h3-5H,1-2H3,(H,12,13) |
| InChIKey | LQKQPUSYFFEBGL-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 85.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-(furan-2-yl)-1,3-dimethyl-7H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(furan-2-yl)-1,3-dimethyl-7H-purine-2,6-dione?
The IUPAC name of 8-(furan-2-yl)-1,3-dimethyl-7H-purine-2,6-dione (CID 2816272) is 8-(furan-2-yl)-1,3-dimethyl-7H-purine-2,6-dione.
What is the SMILES notation for 8-(furan-2-yl)-1,3-dimethyl-7H-purine-2,6-dione?
The canonical SMILES for 8-(furan-2-yl)-1,3-dimethyl-7H-purine-2,6-dione is Cn1c(=O)c2[nH]c(-c3ccco3)nc2n(C)c1=O.
What is the InChIKey of 8-(furan-2-yl)-1,3-dimethyl-7H-purine-2,6-dione?
The InChIKey is LQKQPUSYFFEBGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O3/c1-14-9-7(10(16)15(2)11(14)17)12-8(13-9)6-4-3-5-18-6/h3-5H,1-2H3,(H,12,13).
What are the key properties of 8-(furan-2-yl)-1,3-dimethyl-7H-purine-2,6-dione?
8-(furan-2-yl)-1,3-dimethyl-7H-purine-2,6-dione has a molecular weight of 246.23 g/mol, XLogP of 0.22, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(furan-2-yl)-1,3-dimethyl-7H-purine-2,6-dione is sourced from PubChem (CID 2816272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).