C11H10N4O3 — CID 2816272
8-(furan-2-yl)-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 2816272) has the molecular formula C11H10N4O3 and a molecular weight of 246.23 g/mol. Its IUPAC name is 8-(furan-2-yl)-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-(furan-2-yl)-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 2816272 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 8-(furan-2-yl)-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(-c3ccco3)nc2n(C)c1=O |
| InChI | InChI=1S/C11H10N4O3/c1-14-9-7(10(16)15(2)11(14)17)12-8(13-9)6-4-3-5-18-6/h3-5H,1-2H3,(H,12,13) |
| InChIKey | LQKQPUSYFFEBGL-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 85.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |