C10H10N6O2 — CID 135410228
2,8-diamino-9-(furan-2-ylmethyl)-1H-purin-6-one (PubChem CID 135410228) has the molecular formula C10H10N6O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is 2,8-diamino-9-(furan-2-ylmethyl)-1H-purin-6-one.
| Compound Name | 2,8-diamino-9-(furan-2-ylmethyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 135410228 |
| Molecular Formula | C10H10N6O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2,8-diamino-9-(furan-2-ylmethyl)-1H-purin-6-one |
| SMILES | Nc1nc2c(nc(N)n2Cc2ccco2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H10N6O2/c11-9-14-7-6(8(17)15-9)13-10(12)16(7)4-5-2-1-3-18-5/h1-3H,4H2,(H2,12,13)(H3,11,14,15,17) |
| InChIKey | QKDLJUSXYAHDFI-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 128.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |