C15H18N4O3 — CID 14154537
8-(furan-2-yl)-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 14154537) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 8-(furan-2-yl)-1,3-dipropyl-7H-purine-2,6-dione.
| Compound Name | 8-(furan-2-yl)-1,3-dipropyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 14154537 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 8-(furan-2-yl)-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(-c3ccco3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C15H18N4O3/c1-3-7-18-13-11(14(20)19(8-4-2)15(18)21)16-12(17-13)10-6-5-9-22-10/h5-6,9H,3-4,7-8H2,1-2H3,(H,16,17) |
| InChIKey | XJBFUWXRIXHYGK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 85.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |