C21H22N4O3 — CID 11143352
8-benzyl-3-(furan-2-ylmethyl)-7-methyl-1-propylpurine-2,6-dione (PubChem CID 11143352) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 8-benzyl-3-(furan-2-ylmethyl)-7-methyl-1-propylpurine-2,6-dione.
| Compound Name | 8-benzyl-3-(furan-2-ylmethyl)-7-methyl-1-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 11143352 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 8-benzyl-3-(furan-2-ylmethyl)-7-methyl-1-propylpurine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(Cc3ccccc3)n2C)n(Cc2ccco2)c1=O |
| InChI | InChI=1S/C21H22N4O3/c1-3-11-24-20(26)18-19(25(21(24)27)14-16-10-7-12-28-16)22-17(23(18)2)13-15-8-5-4-6-9-15/h4-10,12H,3,11,13-14H2,1-2H3 |
| InChIKey | CTVYBDZFLIPCGP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 74.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |