C24H25ClN6O2 — CID 67263689
2-[[5-chloro-2-[(4-oxo-1,2,3,5-tetrahydro-3-benzazepin-8-yl)amino]pyrimidin-4-yl]amino]-N,3,5-trimethylbenzamide (PubChem CID 67263689) has the molecular formula C24H25ClN6O2 and a molecular weight of 464.96 g/mol. Its IUPAC name is 2-[[5-chloro-2-[(4-oxo-1,2,3,5-tetrahydro-3-benzazepin-8-yl)amino]pyrimidin-4-yl]amino]-N,3,5-trimethylbenzamide.
| Compound Name | 2-[[5-chloro-2-[(4-oxo-1,2,3,5-tetrahydro-3-benzazepin-8-yl)amino]pyrimidin-4-yl]amino]-N,3,5-trimethylbenzamide |
|---|---|
| PubChem CID | 67263689 |
| Molecular Formula | C24H25ClN6O2 |
| Molecular Weight | 464.96 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 2-[[5-chloro-2-[(4-oxo-1,2,3,5-tetrahydro-3-benzazepin-8-yl)amino]pyrimidin-4-yl]amino]-N,3,5-trimethylbenzamide |
| SMILES | CNC(=O)c1cc(C)cc(C)c1Nc1nc(Nc2ccc3c(c2)CCNC(=O)C3)ncc1Cl |
| InChI | InChI=1S/C24H25ClN6O2/c1-13-8-14(2)21(18(9-13)23(33)26-3)30-22-19(25)12-28-24(31-22)29-17-5-4-15-11-20(32)27-7-6-16(15)10-17/h4-5,8-10,12H,6-7,11H2,1-3H3,(H,26,33)(H,27,32)(H2,28,29,30,31) |
| InChIKey | AMGBSWBTQJYXOB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.96 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |