C15H21N3O2 — CID 67264900
1-(7-amino-3,4-dihydro-2H-1,5-benzoxazepin-5-yl)-2-pyrrolidin-1-ylethanone (PubChem CID 67264900) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-(7-amino-3,4-dihydro-2H-1,5-benzoxazepin-5-yl)-2-pyrrolidin-1-ylethanone.
| Compound Name | 1-(7-amino-3,4-dihydro-2H-1,5-benzoxazepin-5-yl)-2-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 67264900 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 1-(7-amino-3,4-dihydro-2H-1,5-benzoxazepin-5-yl)-2-pyrrolidin-1-ylethanone |
| SMILES | Nc1ccc2c(c1)N(C(=O)CN1CCCC1)CCCO2 |
| InChI | InChI=1S/C15H21N3O2/c16-12-4-5-14-13(10-12)18(8-3-9-20-14)15(19)11-17-6-1-2-7-17/h4-5,10H,1-3,6-9,11,16H2 |
| InChIKey | ODJSENHDJRKBBJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|