C15H16ClFO5S — CID 67267953
methyl 2-(3-chlorophenyl)sulfonyl-2-fluoro-2-(3-oxocyclohexyl)acetate (PubChem CID 67267953) has the molecular formula C15H16ClFO5S and a molecular weight of 362.81 g/mol. Its IUPAC name is methyl 2-(3-chlorophenyl)sulfonyl-2-fluoro-2-(3-oxocyclohexyl)acetate.
| Compound Name | methyl 2-(3-chlorophenyl)sulfonyl-2-fluoro-2-(3-oxocyclohexyl)acetate |
|---|---|
| PubChem CID | 67267953 |
| Molecular Formula | C15H16ClFO5S |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | methyl 2-(3-chlorophenyl)sulfonyl-2-fluoro-2-(3-oxocyclohexyl)acetate |
| SMILES | COC(=O)C(F)(C1CCCC(=O)C1)S(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H16ClFO5S/c1-22-14(19)15(17,10-4-2-6-12(18)8-10)23(20,21)13-7-3-5-11(16)9-13/h3,5,7,9-10H,2,4,6,8H2,1H3 |
| InChIKey | ZHRLIUNSRCCIJT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |