About 8-(4,6-dimethoxypyrimidin-2-yl)sulfinyl-4-methyl-2-phenylphthalazin-1-one
8-(4,6-dimethoxypyrimidin-2-yl)sulfinyl-4-methyl-2-phenylphthalazin-1-one (PubChem CID 67267965) has the molecular formula C21H18N4O4S
and a molecular weight of 422.47 g/mol. Its IUPAC name is 8-(4,6-dimethoxypyrimidin-2-yl)sulfinyl-4-methyl-2-phenylphthalazin-1-one.
Molecular Properties
| Compound Name | 8-(4,6-dimethoxypyrimidin-2-yl)sulfinyl-4-methyl-2-phenylphthalazin-1-one |
| PubChem CID | 67267965 |
| Molecular Formula | C21H18N4O4S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 8-(4,6-dimethoxypyrimidin-2-yl)sulfinyl-4-methyl-2-phenylphthalazin-1-one |
| SMILES | COc1cc(OC)nc(S(=O)c2cccc3c(C)nn(-c4ccccc4)c(=O)c23)n1 |
| InChI | InChI=1S/C21H18N4O4S/c1-13-15-10-7-11-16(30(27)21-22-17(28-2)12-18(23-21)29-3)19(15)20(26)25(24-13)14-8-5-4-6-9-14/h4-12H,1-3H3 |
| InChIKey | FJDMOHXTFKEGFZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 96.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 8-(4,6-dimethoxypyrimidin-2-yl)sulfinyl-4-methyl-2-phenylphthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4,6-dimethoxypyrimidin-2-yl)sulfinyl-4-methyl-2-phenylphthalazin-1-one?
The IUPAC name of 8-(4,6-dimethoxypyrimidin-2-yl)sulfinyl-4-methyl-2-phenylphthalazin-1-one (CID 67267965) is 8-(4,6-dimethoxypyrimidin-2-yl)sulfinyl-4-methyl-2-phenylphthalazin-1-one.
What is the SMILES notation for 8-(4,6-dimethoxypyrimidin-2-yl)sulfinyl-4-methyl-2-phenylphthalazin-1-one?
The canonical SMILES for 8-(4,6-dimethoxypyrimidin-2-yl)sulfinyl-4-methyl-2-phenylphthalazin-1-one is COc1cc(OC)nc(S(=O)c2cccc3c(C)nn(-c4ccccc4)c(=O)c23)n1.
What is the InChIKey of 8-(4,6-dimethoxypyrimidin-2-yl)sulfinyl-4-methyl-2-phenylphthalazin-1-one?
The InChIKey is FJDMOHXTFKEGFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N4O4S/c1-13-15-10-7-11-16(30(27)21-22-17(28-2)12-18(23-21)29-3)19(15)20(26)25(24-13)14-8-5-4-6-9-14/h4-12H,1-3H3.
What are the key properties of 8-(4,6-dimethoxypyrimidin-2-yl)sulfinyl-4-methyl-2-phenylphthalazin-1-one?
8-(4,6-dimethoxypyrimidin-2-yl)sulfinyl-4-methyl-2-phenylphthalazin-1-one has a molecular weight of 422.47 g/mol, XLogP of 2.67, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4,6-dimethoxypyrimidin-2-yl)sulfinyl-4-methyl-2-phenylphthalazin-1-one is sourced from PubChem (CID 67267965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).