C24H24F3N8O5P — CID 67273828
phosphoric acid;3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]-4-[4-(2,3,4-trifluorobenzoyl)piperazin-1-yl]butanenitrile (PubChem CID 67273828) has the molecular formula C24H24F3N8O5P and a molecular weight of 592.48 g/mol. Its IUPAC name is phosphoric acid;3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]-4-[4-(2,3,4-trifluorobenzoyl)piperazin-1-yl]butanenitrile.
| Compound Name | phosphoric acid;3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]-4-[4-(2,3,4-trifluorobenzoyl)piperazin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 67273828 |
| Molecular Formula | C24H24F3N8O5P |
| Molecular Weight | 592.48 g/mol |
| Exact Mass | 592.16 |
| IUPAC Name | phosphoric acid;3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]-4-[4-(2,3,4-trifluorobenzoyl)piperazin-1-yl]butanenitrile |
| SMILES | N#CCC(CN1CCN(C(=O)c2ccc(F)c(F)c2F)CC1)n1cc(-c2ncnc3[nH]ccc23)cn1.O=P(O)(O)O |
| InChI | InChI=1S/C24H21F3N8O.H3O4P/c25-19-2-1-17(20(26)21(19)27)24(36)34-9-7-33(8-10-34)13-16(3-5-28)35-12-15(11-32-35)22-18-4-6-29-23(18)31-14-30-22;1-5(2,3)4/h1-2,4,6,11-12,14,16H,3,7-10,13H2,(H,29,30,31);(H3,1,2,3,4) |
| InChIKey | KSLWCHOHJVZILH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 184.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|