C24H33NO5S — CID 67276615
1-[3-[4-(4,4-dihydroxy-8-methoxy-3-methyl-2,3-dihydro-1,4λ4-benzoxathiin-2-yl)phenoxy]propyl]piperidine (PubChem CID 67276615) has the molecular formula C24H33NO5S and a molecular weight of 447.60 g/mol. Its IUPAC name is 1-[3-[4-(4,4-dihydroxy-8-methoxy-3-methyl-2,3-dihydro-1,4λ4-benzoxathiin-2-yl)phenoxy]propyl]piperidine.
| Compound Name | 1-[3-[4-(4,4-dihydroxy-8-methoxy-3-methyl-2,3-dihydro-1,4λ4-benzoxathiin-2-yl)phenoxy]propyl]piperidine |
|---|---|
| PubChem CID | 67276615 |
| Molecular Formula | C24H33NO5S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 1-[3-[4-(4,4-dihydroxy-8-methoxy-3-methyl-2,3-dihydro-1,4λ4-benzoxathiin-2-yl)phenoxy]propyl]piperidine |
| SMILES | COc1cccc2c1OC(c1ccc(OCCCN3CCCCC3)cc1)C(C)S2(O)O |
| InChI | InChI=1S/C24H33NO5S/c1-18-23(30-24-21(28-2)8-6-9-22(24)31(18,26)27)19-10-12-20(13-11-19)29-17-7-16-25-14-4-3-5-15-25/h6,8-13,18,23,26-27H,3-5,7,14-17H2,1-2H3 |
| InChIKey | PDXXKUDWLXLGHO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|