C23H31NO5S — CID 68725340
(2S,3S)-8-methoxy-3-methyl-2-[4-(3-pyrrolidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]-2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide (PubChem CID 68725340) has the molecular formula C23H31NO5S and a molecular weight of 433.57 g/mol. Its IUPAC name is (2S,3S)-8-methoxy-3-methyl-2-[4-(3-pyrrolidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]-2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide.
| Compound Name | (2S,3S)-8-methoxy-3-methyl-2-[4-(3-pyrrolidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]-2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide |
|---|---|
| PubChem CID | 68725340 |
| Molecular Formula | C23H31NO5S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | (2S,3S)-8-methoxy-3-methyl-2-[4-(3-pyrrolidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]-2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide |
| SMILES | COc1cccc2c1O[C@@H](C1C=CC(OCCCN3CCCC3)=CC1)[C@H](C)S2(=O)=O |
| InChI | InChI=1S/C23H31NO5S/c1-17-22(29-23-20(27-2)7-5-8-21(23)30(17,25)26)18-9-11-19(12-10-18)28-16-6-15-24-13-3-4-14-24/h5,7-9,11-12,17-18,22H,3-4,6,10,13-16H2,1-2H3/t17-,18?,22+/m0/s1 |
| InChIKey | YWGRSZLBBQYKPR-UMJFLEMOSA-N |
| XLogP | 3.58 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|