C16H25N3O2S — CID 67276967
4-[5-(3,3-dimethylbutyliminomethyl)-1,3-thiazol-2-yl]piperidine-1-carboxylic acid (PubChem CID 67276967) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is 4-[5-(3,3-dimethylbutyliminomethyl)-1,3-thiazol-2-yl]piperidine-1-carboxylic acid.
| Compound Name | 4-[5-(3,3-dimethylbutyliminomethyl)-1,3-thiazol-2-yl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67276967 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 4-[5-(3,3-dimethylbutyliminomethyl)-1,3-thiazol-2-yl]piperidine-1-carboxylic acid |
| SMILES | CC(C)(C)CC/N=C/c1cnc(C2CCN(C(=O)O)CC2)s1 |
| InChI | InChI=1S/C16H25N3O2S/c1-16(2,3)6-7-17-10-13-11-18-14(22-13)12-4-8-19(9-5-12)15(20)21/h10-12H,4-9H2,1-3H3,(H,20,21)/b17-10+ |
| InChIKey | ZTCZLYDXBVAPKW-LICLKQGHSA-N |
| XLogP | 3.86 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|