C20H26N2O2S — CID 18187483
tert-butyl 4-(2-benzyl-1,3-thiazol-5-yl)piperidine-1-carboxylate (PubChem CID 18187483) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is tert-butyl 4-(2-benzyl-1,3-thiazol-5-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-benzyl-1,3-thiazol-5-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 18187483 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | tert-butyl 4-(2-benzyl-1,3-thiazol-5-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cnc(Cc3ccccc3)s2)CC1 |
| InChI | InChI=1S/C20H26N2O2S/c1-20(2,3)24-19(23)22-11-9-16(10-12-22)17-14-21-18(25-17)13-15-7-5-4-6-8-15/h4-8,14,16H,9-13H2,1-3H3 |
| InChIKey | KBJCOKHEPYMZFK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |