C20H26IN3O2 — CID 139271771
tert-butyl 4-(2-benzyl-4-iodo-1H-imidazol-5-yl)piperidine-1-carboxylate (PubChem CID 139271771) has the molecular formula C20H26IN3O2 and a molecular weight of 467.35 g/mol. Its IUPAC name is tert-butyl 4-(2-benzyl-4-iodo-1H-imidazol-5-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-benzyl-4-iodo-1H-imidazol-5-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139271771 |
| Molecular Formula | C20H26IN3O2 |
| Molecular Weight | 467.35 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | tert-butyl 4-(2-benzyl-4-iodo-1H-imidazol-5-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2[nH]c(Cc3ccccc3)nc2I)CC1 |
| InChI | InChI=1S/C20H26IN3O2/c1-20(2,3)26-19(25)24-11-9-15(10-12-24)17-18(21)23-16(22-17)13-14-7-5-4-6-8-14/h4-8,15H,9-13H2,1-3H3,(H,22,23) |
| InChIKey | HBRQERLIVCUZGV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.35 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|