C23H32O3SSi — CID 67277297
2-(2-hydroxyphenyl)sulfanyl-1-[4-tri(propan-2-yl)silyloxyphenyl]ethanone (PubChem CID 67277297) has the molecular formula C23H32O3SSi and a molecular weight of 416.66 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)sulfanyl-1-[4-tri(propan-2-yl)silyloxyphenyl]ethanone.
| Compound Name | 2-(2-hydroxyphenyl)sulfanyl-1-[4-tri(propan-2-yl)silyloxyphenyl]ethanone |
|---|---|
| PubChem CID | 67277297 |
| Molecular Formula | C23H32O3SSi |
| Molecular Weight | 416.66 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 2-(2-hydroxyphenyl)sulfanyl-1-[4-tri(propan-2-yl)silyloxyphenyl]ethanone |
| SMILES | CC(C)[Si](Oc1ccc(C(=O)CSc2ccccc2O)cc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H32O3SSi/c1-16(2)28(17(3)4,18(5)6)26-20-13-11-19(12-14-20)22(25)15-27-23-10-8-7-9-21(23)24/h7-14,16-18,24H,15H2,1-6H3 |
| InChIKey | NLCUTYRASMYQOO-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.66 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|