C17H31N2Si — CID 67277866
bis(N,N-diethylamino)(phenethyl)methylsilane (PubChem CID 67277866) has the molecular formula C17H31N2Si and a molecular weight of 291.53 g/mol.
| Compound Name | bis(N,N-diethylamino)(phenethyl)methylsilane |
|---|---|
| PubChem CID | 67277866 |
| Molecular Formula | C17H31N2Si |
| Molecular Weight | 291.53 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | — |
| SMILES | CCN(CC)[Si](CCCc1ccccc1)N(CC)CC |
| InChI | InChI=1S/C17H31N2Si/c1-5-18(6-2)20(19(7-3)8-4)16-12-15-17-13-10-9-11-14-17/h9-11,13-14H,5-8,12,15-16H2,1-4H3 |
| InChIKey | ZMFBVAMQKDAZCK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|