C13H15N5O3S — CID 67278113
3-[(3S)-1-methylsulfonylpyrrolidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one (PubChem CID 67278113) has the molecular formula C13H15N5O3S and a molecular weight of 321.36 g/mol. Its IUPAC name is 3-[(3S)-1-methylsulfonylpyrrolidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one.
| Compound Name | 3-[(3S)-1-methylsulfonylpyrrolidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
|---|---|
| PubChem CID | 67278113 |
| Molecular Formula | C13H15N5O3S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 3-[(3S)-1-methylsulfonylpyrrolidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
| SMILES | CS(=O)(=O)N1CC[C@H](n2c(=O)[nH]c3cnc4[nH]ccc4c32)C1 |
| InChI | InChI=1S/C13H15N5O3S/c1-22(20,21)17-5-3-8(7-17)18-11-9-2-4-14-12(9)15-6-10(11)16-13(18)19/h2,4,6,8H,3,5,7H2,1H3,(H,14,15)(H,16,19)/t8-/m0/s1 |
| InChIKey | NUMCACVRNMLLFU-QMMMGPOBSA-N |
| XLogP | 0.41 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |