C18H23Cl2N5O — CID 66959414
3-(5-amino-2-adamantyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one;dihydrochloride (PubChem CID 66959414) has the molecular formula C18H23Cl2N5O and a molecular weight of 396.32 g/mol. Its IUPAC name is 3-(5-amino-2-adamantyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one;dihydrochloride.
| Compound Name | 3-(5-amino-2-adamantyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one;dihydrochloride |
|---|---|
| PubChem CID | 66959414 |
| Molecular Formula | C18H23Cl2N5O |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 3-(5-amino-2-adamantyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one;dihydrochloride |
| SMILES | Cl.Cl.NC12CC3CC(C1)C(n1c(=O)[nH]c4cnc5[nH]ccc5c41)C(C3)C2 |
| InChI | InChI=1S/C18H21N5O.2ClH/c19-18-5-9-3-10(6-18)14(11(4-9)7-18)23-15-12-1-2-20-16(12)21-8-13(15)22-17(23)24;;/h1-2,8-11,14H,3-7,19H2,(H,20,21)(H,22,24);2*1H |
| InChIKey | UNHCRCGJTUBCLQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |