C19H21N3O — CID 66726973
(3R,5S)-4-(3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)adamantan-1-ol (PubChem CID 66726973) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is (3R,5S)-4-(3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)adamantan-1-ol.
| Compound Name | (3R,5S)-4-(3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)adamantan-1-ol |
|---|---|
| PubChem CID | 66726973 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | (3R,5S)-4-(3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)adamantan-1-ol |
| SMILES | OC12CC3C[C@H](C1)C(n1ccc4cnc5[nH]ccc5c41)[C@@H](C3)C2 |
| InChI | InChI=1S/C19H21N3O/c23-19-7-11-5-13(8-19)16(14(6-11)9-19)22-4-2-12-10-21-18-15(17(12)22)1-3-20-18/h1-4,10-11,13-14,16,23H,5-9H2,(H,20,21)/t11?,13-,14+,16?,19? |
| InChIKey | SMBYLFBNUVTTTD-MOQPJMLJSA-N |
| XLogP | 3.63 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |