C18H21BN4O2 — CID 155724228
4-(10-hydroxy-5,7,11,12-tetraza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)adamantan-1-ol (PubChem CID 155724228) has the molecular formula C18H21BN4O2 and a molecular weight of 336.20 g/mol. Its IUPAC name is 4-(10-hydroxy-5,7,11,12-tetraza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)adamantan-1-ol.
| Compound Name | 4-(10-hydroxy-5,7,11,12-tetraza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)adamantan-1-ol |
|---|---|
| PubChem CID | 155724228 |
| Molecular Formula | C18H21BN4O2 |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 4-(10-hydroxy-5,7,11,12-tetraza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)adamantan-1-ol |
| SMILES | OB1NN=C(C2C3CC4CC2CC(O)(C4)C3)c2c1cnc1[nH]ccc21 |
| InChI | InChI=1S/C18H21BN4O2/c24-18-5-9-3-10(6-18)14(11(4-9)7-18)16-15-12-1-2-20-17(12)21-8-13(15)19(25)23-22-16/h1-2,8-11,14,23-25H,3-7H2,(H,20,21) |
| InChIKey | PRLKBSBVEVBNOB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|