C20H25BN4O2 — CID 159005534
4-(11-ethyl-10-hydroxy-5,7,11,12-tetraza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)adamantan-1-ol (PubChem CID 159005534) has the molecular formula C20H25BN4O2 and a molecular weight of 364.26 g/mol. Its IUPAC name is 4-(11-ethyl-10-hydroxy-5,7,11,12-tetraza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)adamantan-1-ol.
| Compound Name | 4-(11-ethyl-10-hydroxy-5,7,11,12-tetraza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)adamantan-1-ol |
|---|---|
| PubChem CID | 159005534 |
| Molecular Formula | C20H25BN4O2 |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 4-(11-ethyl-10-hydroxy-5,7,11,12-tetraza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)adamantan-1-ol |
| SMILES | CCN1N=C(C2C3CC4CC2CC(O)(C4)C3)c2c(cnc3[nH]ccc23)B1O |
| InChI | InChI=1S/C20H25BN4O2/c1-2-25-21(27)15-10-23-19-14(3-4-22-19)17(15)18(24-25)16-12-5-11-6-13(16)9-20(26,7-11)8-12/h3-4,10-13,16,26-27H,2,5-9H2,1H3,(H,22,23) |
| InChIKey | JRWHNGGQXOLSED-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 84.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|