C21H25BN4O2 — CID 159119262
4-(3-oxa-7,8,14,16-tetraza-2-boratetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),8,10,12,15-pentaen-9-yl)adamantan-1-ol (PubChem CID 159119262) has the molecular formula C21H25BN4O2 and a molecular weight of 376.27 g/mol. Its IUPAC name is 4-(3-oxa-7,8,14,16-tetraza-2-boratetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),8,10,12,15-pentaen-9-yl)adamantan-1-ol.
| Compound Name | 4-(3-oxa-7,8,14,16-tetraza-2-boratetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),8,10,12,15-pentaen-9-yl)adamantan-1-ol |
|---|---|
| PubChem CID | 159119262 |
| Molecular Formula | C21H25BN4O2 |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 4-(3-oxa-7,8,14,16-tetraza-2-boratetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),8,10,12,15-pentaen-9-yl)adamantan-1-ol |
| SMILES | OC12CC3CC(C1)C(C1=NN4CCCOB4c4cnc5[nH]ccc5c41)C(C3)C2 |
| InChI | InChI=1S/C21H25BN4O2/c27-21-8-12-6-13(9-21)17(14(7-12)10-21)19-18-15-2-3-23-20(15)24-11-16(18)22-26(25-19)4-1-5-28-22/h2-3,11-14,17,27H,1,4-10H2,(H,23,24) |
| InChIKey | FHEYLFMSFGYYOZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|