C23H27BN4O2 — CID 163993129
(2S,5R,6S,7S)-6-(4,4-dimethyl-3-oxa-7,8,14,16-tetraza-2-boratetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),8,10,12,15-pentaen-9-yl)tetracyclo[5.3.0.02,5.03,9]decan-3-ol (PubChem CID 163993129) has the molecular formula C23H27BN4O2 and a molecular weight of 402.31 g/mol. Its IUPAC name is (2S,5R,6S,7S)-6-(4,4-dimethyl-3-oxa-7,8,14,16-tetraza-2-boratetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),8,10,12,15-pentaen-9-yl)tetracyclo[5.3.0.02,5.03,9]decan-3-ol.
| Compound Name | (2S,5R,6S,7S)-6-(4,4-dimethyl-3-oxa-7,8,14,16-tetraza-2-boratetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),8,10,12,15-pentaen-9-yl)tetracyclo[5.3.0.02,5.03,9]decan-3-ol |
|---|---|
| PubChem CID | 163993129 |
| Molecular Formula | C23H27BN4O2 |
| Molecular Weight | 402.31 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | (2S,5R,6S,7S)-6-(4,4-dimethyl-3-oxa-7,8,14,16-tetraza-2-boratetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),8,10,12,15-pentaen-9-yl)tetracyclo[5.3.0.02,5.03,9]decan-3-ol |
| SMILES | CC1(C)CCN2N=C([C@H]3[C@H]4CC5CC4C4[C@@H]3CC54O)c3c(cnc4[nH]ccc34)B2O1 |
| InChI | InChI=1S/C23H27BN4O2/c1-22(2)4-6-28-24(30-22)16-10-26-21-12(3-5-25-21)18(16)20(27-28)17-13-7-11-8-14(13)19-15(17)9-23(11,19)29/h3,5,10-11,13-15,17,19,29H,4,6-9H2,1-2H3,(H,25,26)/t11?,13-,14?,15+,17-,19?,23?/m0/s1 |
| InChIKey | UCJQRVJQWRKIGD-GYLLWTGOSA-N |
| XLogP | 2.13 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|