About tert-butyl-[(1R,3R)-3-cyanocyclohexyl]carbamic acid
tert-butyl-[(1R,3R)-3-cyanocyclohexyl]carbamic acid (PubChem CID 67278135) has the molecular formula C12H20N2O2
and a molecular weight of 224.30 g/mol. Its IUPAC name is tert-butyl-[(1R,3R)-3-cyanocyclohexyl]carbamic acid.
Molecular Properties
| Compound Name | tert-butyl-[(1R,3R)-3-cyanocyclohexyl]carbamic acid |
| PubChem CID | 67278135 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | tert-butyl-[(1R,3R)-3-cyanocyclohexyl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)[C@@H]1CCC[C@@H](C#N)C1 |
| InChI | InChI=1S/C12H20N2O2/c1-12(2,3)14(11(15)16)10-6-4-5-9(7-10)8-13/h9-10H,4-7H2,1-3H3,(H,15,16)/t9-,10-/m1/s1 |
| InChIKey | MRWAMPCXSWAVDM-NXEZZACHSA-N |
| XLogP | 2.85 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl-[(1R,3R)-3-cyanocyclohexyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(1R,3R)-3-cyanocyclohexyl]carbamic acid?
The IUPAC name of tert-butyl-[(1R,3R)-3-cyanocyclohexyl]carbamic acid (CID 67278135) is tert-butyl-[(1R,3R)-3-cyanocyclohexyl]carbamic acid.
What is the SMILES notation for tert-butyl-[(1R,3R)-3-cyanocyclohexyl]carbamic acid?
The canonical SMILES for tert-butyl-[(1R,3R)-3-cyanocyclohexyl]carbamic acid is CC(C)(C)N(C(=O)O)[C@@H]1CCC[C@@H](C#N)C1.
What is the InChIKey of tert-butyl-[(1R,3R)-3-cyanocyclohexyl]carbamic acid?
The InChIKey is MRWAMPCXSWAVDM-NXEZZACHSA-N. The full InChI is InChI=1S/C12H20N2O2/c1-12(2,3)14(11(15)16)10-6-4-5-9(7-10)8-13/h9-10H,4-7H2,1-3H3,(H,15,16)/t9-,10-/m1/s1.
What are the key properties of tert-butyl-[(1R,3R)-3-cyanocyclohexyl]carbamic acid?
tert-butyl-[(1R,3R)-3-cyanocyclohexyl]carbamic acid has a molecular weight of 224.30 g/mol, XLogP of 2.85, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(1R,3R)-3-cyanocyclohexyl]carbamic acid is sourced from PubChem (CID 67278135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).