C24H21FO3 — CID 67283881
8-(4-fluorophenyl)-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 67283881) has the molecular formula C24H21FO3 and a molecular weight of 376.43 g/mol. Its IUPAC name is 8-(4-fluorophenyl)-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 8-(4-fluorophenyl)-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 67283881 |
| Molecular Formula | C24H21FO3 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 8-(4-fluorophenyl)-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | Cc1cc(C)c(C2C(=O)C3C4C=C(c5ccc(F)cc5)C(O4)C3C2=O)c(C)c1 |
| InChI | InChI=1S/C24H21FO3/c1-11-8-12(2)18(13(3)9-11)20-22(26)19-17-10-16(14-4-6-15(25)7-5-14)24(28-17)21(19)23(20)27/h4-10,17,19-21,24H,1-3H3 |
| InChIKey | BSTCPKBFGKEXDS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|