C26H28ClFN2O4S — CID 67288522
N-[4-[(E)-2-[3-tert-butyl-5-[1-(chloromethyl)-5-fluoro-2-oxo-3-pyridinyl]-2-methoxyphenyl]ethenyl]phenyl]methanesulfonamide (PubChem CID 67288522) has the molecular formula C26H28ClFN2O4S and a molecular weight of 519.04 g/mol. Its IUPAC name is N-[4-[(E)-2-[3-tert-butyl-5-[1-(chloromethyl)-5-fluoro-2-oxo-3-pyridinyl]-2-methoxyphenyl]ethenyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(E)-2-[3-tert-butyl-5-[1-(chloromethyl)-5-fluoro-2-oxo-3-pyridinyl]-2-methoxyphenyl]ethenyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 67288522 |
| Molecular Formula | C26H28ClFN2O4S |
| Molecular Weight | 519.04 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | N-[4-[(E)-2-[3-tert-butyl-5-[1-(chloromethyl)-5-fluoro-2-oxo-3-pyridinyl]-2-methoxyphenyl]ethenyl]phenyl]methanesulfonamide |
| SMILES | COc1c(/C=C/c2ccc(NS(C)(=O)=O)cc2)cc(-c2cc(F)cn(CCl)c2=O)cc1C(C)(C)C |
| InChI | InChI=1S/C26H28ClFN2O4S/c1-26(2,3)23-13-19(22-14-20(28)15-30(16-27)25(22)31)12-18(24(23)34-4)9-6-17-7-10-21(11-8-17)29-35(5,32)33/h6-15,29H,16H2,1-5H3/b9-6+ |
| InChIKey | JFWLVKXFSYVPHD-RMKNXTFCSA-N |
| XLogP | 5.70 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.04 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|