C12H24N6O — CID 67291787
(2S)-2-amino-N-[(2-tert-butyltetrazol-5-yl)methyl]-3-methylpentanamide (PubChem CID 67291787) has the molecular formula C12H24N6O and a molecular weight of 268.37 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2-tert-butyltetrazol-5-yl)methyl]-3-methylpentanamide.
| Compound Name | (2S)-2-amino-N-[(2-tert-butyltetrazol-5-yl)methyl]-3-methylpentanamide |
|---|---|
| PubChem CID | 67291787 |
| Molecular Formula | C12H24N6O |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | (2S)-2-amino-N-[(2-tert-butyltetrazol-5-yl)methyl]-3-methylpentanamide |
| SMILES | CCC(C)[C@H](N)C(=O)NCc1nnn(C(C)(C)C)n1 |
| InChI | InChI=1S/C12H24N6O/c1-6-8(2)10(13)11(19)14-7-9-15-17-18(16-9)12(3,4)5/h8,10H,6-7,13H2,1-5H3,(H,14,19)/t8?,10-/m0/s1 |
| InChIKey | UCBWIWUJDATMDD-HTLJXXAVSA-N |
| XLogP | 0.42 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |