C11H22N6O — CID 68754874
(2S)-2-amino-N-(2-tert-butyltetrazol-5-yl)-3-methylpentanamide (PubChem CID 68754874) has the molecular formula C11H22N6O and a molecular weight of 254.34 g/mol. Its IUPAC name is (2S)-2-amino-N-(2-tert-butyltetrazol-5-yl)-3-methylpentanamide.
| Compound Name | (2S)-2-amino-N-(2-tert-butyltetrazol-5-yl)-3-methylpentanamide |
|---|---|
| PubChem CID | 68754874 |
| Molecular Formula | C11H22N6O |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (2S)-2-amino-N-(2-tert-butyltetrazol-5-yl)-3-methylpentanamide |
| SMILES | CCC(C)[C@H](N)C(=O)Nc1nnn(C(C)(C)C)n1 |
| InChI | InChI=1S/C11H22N6O/c1-6-7(2)8(12)9(18)13-10-14-16-17(15-10)11(3,4)5/h7-8H,6,12H2,1-5H3,(H,13,15,18)/t7?,8-/m0/s1 |
| InChIKey | CXFAWVVCQPWQMS-MQWKRIRWSA-N |
| XLogP | 0.74 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |