C17H12F3NO3S2 — CID 67299254
N-(5-phenylthiophen-3-yl)-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 67299254) has the molecular formula C17H12F3NO3S2 and a molecular weight of 399.42 g/mol. Its IUPAC name is N-(5-phenylthiophen-3-yl)-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(5-phenylthiophen-3-yl)-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 67299254 |
| Molecular Formula | C17H12F3NO3S2 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | N-(5-phenylthiophen-3-yl)-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1csc(-c2ccccc2)c1)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C17H12F3NO3S2/c18-17(19,20)24-14-8-4-5-9-16(14)26(22,23)21-13-10-15(25-11-13)12-6-2-1-3-7-12/h1-11,21H |
| InChIKey | CJFUTUOFUIXBNL-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |