C28H46N6O2 — CID 67301279
(3S,6S,10aS)-N-[[3-[[(E)-4-(dimethylamino)but-2-enyl]amino]phenyl]methyl]-6-[[(2S)-2-(methylamino)propyl]amino]-5-oxo-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide (PubChem CID 67301279) has the molecular formula C28H46N6O2 and a molecular weight of 498.72 g/mol. Its IUPAC name is (3S,6S,10aS)-N-[[3-[[(E)-4-(dimethylamino)but-2-enyl]amino]phenyl]methyl]-6-[[(2S)-2-(methylamino)propyl]amino]-5-oxo-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide.
| Compound Name | (3S,6S,10aS)-N-[[3-[[(E)-4-(dimethylamino)but-2-enyl]amino]phenyl]methyl]-6-[[(2S)-2-(methylamino)propyl]amino]-5-oxo-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide |
|---|---|
| PubChem CID | 67301279 |
| Molecular Formula | C28H46N6O2 |
| Molecular Weight | 498.72 g/mol |
| Exact Mass | 498.37 |
| IUPAC Name | (3S,6S,10aS)-N-[[3-[[(E)-4-(dimethylamino)but-2-enyl]amino]phenyl]methyl]-6-[[(2S)-2-(methylamino)propyl]amino]-5-oxo-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide |
| SMILES | CN[C@@H](C)CN[C@H]1CCCC[C@H]2CC[C@@H](C(=O)NCc3cccc(NC/C=C/CN(C)C)c3)N2C1=O |
| InChI | InChI=1S/C28H46N6O2/c1-21(29-2)19-31-25-13-6-5-12-24-14-15-26(34(24)28(25)36)27(35)32-20-22-10-9-11-23(18-22)30-16-7-8-17-33(3)4/h7-11,18,21,24-26,29-31H,5-6,12-17,19-20H2,1-4H3,(H,32,35)/b8-7+/t21-,24-,25-,26-/m0/s1 |
| InChIKey | XVZIYXOXPZOTLX-BZTBXGLDSA-N |
| XLogP | 2.33 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.72 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|