C19H14ClN3O — CID 673060
(2R)-3-(2-chlorophenyl)-2-pyridin-4-yl-1,2-dihydroquinazolin-4-one (PubChem CID 673060) has the molecular formula C19H14ClN3O and a molecular weight of 335.79 g/mol. Its IUPAC name is (2R)-3-(2-chlorophenyl)-2-pyridin-4-yl-1,2-dihydroquinazolin-4-one.
| Compound Name | (2R)-3-(2-chlorophenyl)-2-pyridin-4-yl-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 673060 |
| Molecular Formula | C19H14ClN3O |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | (2R)-3-(2-chlorophenyl)-2-pyridin-4-yl-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2N[C@@H](c2ccncc2)N1c1ccccc1Cl |
| InChI | InChI=1S/C19H14ClN3O/c20-15-6-2-4-8-17(15)23-18(13-9-11-21-12-10-13)22-16-7-3-1-5-14(16)19(23)24/h1-12,18,22H/t18-/m1/s1 |
| InChIKey | WREREZOJTWGLBN-GOSISDBHSA-N |
| XLogP | 4.51 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |