C21H20N6O — CID 67306410
1-phenyl-3-[6-(1-phenylethylamino)imidazo[1,2-b]pyridazin-3-yl]urea (PubChem CID 67306410) has the molecular formula C21H20N6O and a molecular weight of 372.43 g/mol. Its IUPAC name is 1-phenyl-3-[6-(1-phenylethylamino)imidazo[1,2-b]pyridazin-3-yl]urea.
| Compound Name | 1-phenyl-3-[6-(1-phenylethylamino)imidazo[1,2-b]pyridazin-3-yl]urea |
|---|---|
| PubChem CID | 67306410 |
| Molecular Formula | C21H20N6O |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 1-phenyl-3-[6-(1-phenylethylamino)imidazo[1,2-b]pyridazin-3-yl]urea |
| SMILES | CC(Nc1ccc2ncc(NC(=O)Nc3ccccc3)n2n1)c1ccccc1 |
| InChI | InChI=1S/C21H20N6O/c1-15(16-8-4-2-5-9-16)23-18-12-13-19-22-14-20(27(19)26-18)25-21(28)24-17-10-6-3-7-11-17/h2-15H,1H3,(H,23,26)(H2,24,25,28) |
| InChIKey | MLUHUAVKQZFTCA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 83.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |