C13H9BrN2O2 — CID 67308910
1-[(3-bromophenyl)methyl]-3-ethynylpyrimidine-2,4-dione (PubChem CID 67308910) has the molecular formula C13H9BrN2O2 and a molecular weight of 305.13 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-3-ethynylpyrimidine-2,4-dione.
| Compound Name | 1-[(3-bromophenyl)methyl]-3-ethynylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67308910 |
| Molecular Formula | C13H9BrN2O2 |
| Molecular Weight | 305.13 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-3-ethynylpyrimidine-2,4-dione |
| SMILES | C#Cn1c(=O)ccn(Cc2cccc(Br)c2)c1=O |
| InChI | InChI=1S/C13H9BrN2O2/c1-2-16-12(17)6-7-15(13(16)18)9-10-4-3-5-11(14)8-10/h1,3-8H,9H2 |
| InChIKey | WXSZFLJEZGAARZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.13 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|