C18H25N5O3S — CID 67312986
3-cyclopentyl-2-(4-ethylsulfonylimidazol-1-yl)-N-(5-methylpyrazin-2-yl)propanamide (PubChem CID 67312986) has the molecular formula C18H25N5O3S and a molecular weight of 391.50 g/mol. Its IUPAC name is 3-cyclopentyl-2-(4-ethylsulfonylimidazol-1-yl)-N-(5-methylpyrazin-2-yl)propanamide.
| Compound Name | 3-cyclopentyl-2-(4-ethylsulfonylimidazol-1-yl)-N-(5-methylpyrazin-2-yl)propanamide |
|---|---|
| PubChem CID | 67312986 |
| Molecular Formula | C18H25N5O3S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 3-cyclopentyl-2-(4-ethylsulfonylimidazol-1-yl)-N-(5-methylpyrazin-2-yl)propanamide |
| SMILES | CCS(=O)(=O)c1cn(C(CC2CCCC2)C(=O)Nc2cnc(C)cn2)cn1 |
| InChI | InChI=1S/C18H25N5O3S/c1-3-27(25,26)17-11-23(12-21-17)15(8-14-6-4-5-7-14)18(24)22-16-10-19-13(2)9-20-16/h9-12,14-15H,3-8H2,1-2H3,(H,20,22,24) |
| InChIKey | IMVHWFMWVULNML-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |