C10H22Cl2N2 — CID 67315320
(3S,4R)-3-methyl-4-pyrrolidin-1-ylpiperidine;dihydrochloride (PubChem CID 67315320) has the molecular formula C10H22Cl2N2 and a molecular weight of 241.21 g/mol. Its IUPAC name is (3S,4R)-3-methyl-4-pyrrolidin-1-ylpiperidine;dihydrochloride.
| Compound Name | (3S,4R)-3-methyl-4-pyrrolidin-1-ylpiperidine;dihydrochloride |
|---|---|
| PubChem CID | 67315320 |
| Molecular Formula | C10H22Cl2N2 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | (3S,4R)-3-methyl-4-pyrrolidin-1-ylpiperidine;dihydrochloride |
| SMILES | C[C@H]1CNCC[C@H]1N1CCCC1.Cl.Cl |
| InChI | InChI=1S/C10H20N2.2ClH/c1-9-8-11-5-4-10(9)12-6-2-3-7-12;;/h9-11H,2-8H2,1H3;2*1H/t9-,10+;;/m0../s1 |
| InChIKey | AIWWJXISDQYETG-JXGSBULDSA-N |
| XLogP | 1.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |