C19H18F3NO2S — CID 67315447
N-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-ylmethyl)-5-(2,2,2-trifluoroacetyl)thiophene-2-carboxamide (PubChem CID 67315447) has the molecular formula C19H18F3NO2S and a molecular weight of 381.42 g/mol. Its IUPAC name is N-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-ylmethyl)-5-(2,2,2-trifluoroacetyl)thiophene-2-carboxamide.
| Compound Name | N-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-ylmethyl)-5-(2,2,2-trifluoroacetyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 67315447 |
| Molecular Formula | C19H18F3NO2S |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-ylmethyl)-5-(2,2,2-trifluoroacetyl)thiophene-2-carboxamide |
| SMILES | O=C(NCC1CCCCc2ccccc21)c1ccc(C(=O)C(F)(F)F)s1 |
| InChI | InChI=1S/C19H18F3NO2S/c20-19(21,22)17(24)15-9-10-16(26-15)18(25)23-11-13-7-2-1-5-12-6-3-4-8-14(12)13/h3-4,6,8-10,13H,1-2,5,7,11H2,(H,23,25) |
| InChIKey | BTIOHDWCXDNKCU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |