C20H18F6N2O4S — CID 171926873
N-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-5-(2,2,2-trifluoroacetyl)thiophene-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 171926873) has the molecular formula C20H18F6N2O4S and a molecular weight of 496.43 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-5-(2,2,2-trifluoroacetyl)thiophene-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-5-(2,2,2-trifluoroacetyl)thiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171926873 |
| Molecular Formula | C20H18F6N2O4S |
| Molecular Weight | 496.43 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | N-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-5-(2,2,2-trifluoroacetyl)thiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCCN1CCCc2ccccc21)c1ccc(C(=O)C(F)(F)F)s1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H17F3N2O2S.C2HF3O2/c19-18(20,21)16(24)14-7-8-15(26-14)17(25)22-9-11-23-10-3-5-12-4-1-2-6-13(12)23;3-2(4,5)1(6)7/h1-2,4,6-8H,3,5,9-11H2,(H,22,25);(H,6,7) |
| InChIKey | VJMQDZHQMJPKHE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |