C30H19N5S — CID 67317431
4-[4-[(4-phenylphthalazin-1-yl)amino]phenyl]sulfanylquinoline-7-carbonitrile (PubChem CID 67317431) has the molecular formula C30H19N5S and a molecular weight of 481.58 g/mol. Its IUPAC name is 4-[4-[(4-phenylphthalazin-1-yl)amino]phenyl]sulfanylquinoline-7-carbonitrile.
| Compound Name | 4-[4-[(4-phenylphthalazin-1-yl)amino]phenyl]sulfanylquinoline-7-carbonitrile |
|---|---|
| PubChem CID | 67317431 |
| Molecular Formula | C30H19N5S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 4-[4-[(4-phenylphthalazin-1-yl)amino]phenyl]sulfanylquinoline-7-carbonitrile |
| SMILES | N#Cc1ccc2c(Sc3ccc(Nc4nnc(-c5ccccc5)c5ccccc45)cc3)ccnc2c1 |
| InChI | InChI=1S/C30H19N5S/c31-19-20-10-15-26-27(18-20)32-17-16-28(26)36-23-13-11-22(12-14-23)33-30-25-9-5-4-8-24(25)29(34-35-30)21-6-2-1-3-7-21/h1-18H,(H,33,35) |
| InChIKey | SLOHDIVSOLPBIP-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |