C30H20N6O2 — CID 67318035
4-[4-[[4-(6-methoxy-2-pyridinyl)phthalazin-1-yl]amino]phenoxy]quinoline-7-carbonitrile (PubChem CID 67318035) has the molecular formula C30H20N6O2 and a molecular weight of 496.53 g/mol. Its IUPAC name is 4-[4-[[4-(6-methoxy-2-pyridinyl)phthalazin-1-yl]amino]phenoxy]quinoline-7-carbonitrile.
| Compound Name | 4-[4-[[4-(6-methoxy-2-pyridinyl)phthalazin-1-yl]amino]phenoxy]quinoline-7-carbonitrile |
|---|---|
| PubChem CID | 67318035 |
| Molecular Formula | C30H20N6O2 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 4-[4-[[4-(6-methoxy-2-pyridinyl)phthalazin-1-yl]amino]phenoxy]quinoline-7-carbonitrile |
| SMILES | COc1cccc(-c2nnc(Nc3ccc(Oc4ccnc5cc(C#N)ccc45)cc3)c3ccccc23)n1 |
| InChI | InChI=1S/C30H20N6O2/c1-37-28-8-4-7-25(34-28)29-22-5-2-3-6-23(22)30(36-35-29)33-20-10-12-21(13-11-20)38-27-15-16-32-26-17-19(18-31)9-14-24(26)27/h2-17H,1H3,(H,33,36) |
| InChIKey | JFQLJLOIYFTPEA-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |