About 2,5-bis(bromomethyl)-1,4-dithiane
2,5-bis(bromomethyl)-1,4-dithiane (PubChem CID 67319976) has the molecular formula C6H10Br2S2
and a molecular weight of 306.09 g/mol. Its IUPAC name is 2,5-bis(bromomethyl)-1,4-dithiane.
Molecular Properties
| Compound Name | 2,5-bis(bromomethyl)-1,4-dithiane |
| PubChem CID | 67319976 |
| Molecular Formula | C6H10Br2S2 |
| Molecular Weight | 306.09 g/mol |
| Exact Mass | 303.86 |
| IUPAC Name | 2,5-bis(bromomethyl)-1,4-dithiane |
| SMILES | BrCC1CSC(CBr)CS1 |
| InChI | InChI=1S/C6H10Br2S2/c7-1-5-3-10-6(2-8)4-9-5/h5-6H,1-4H2 |
| InChIKey | MNGAWPOJPNONED-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.09 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis(bromomethyl)-1,4-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(bromomethyl)-1,4-dithiane?
The IUPAC name of 2,5-bis(bromomethyl)-1,4-dithiane (CID 67319976) is 2,5-bis(bromomethyl)-1,4-dithiane.
What is the SMILES notation for 2,5-bis(bromomethyl)-1,4-dithiane?
The canonical SMILES for 2,5-bis(bromomethyl)-1,4-dithiane is BrCC1CSC(CBr)CS1.
What is the InChIKey of 2,5-bis(bromomethyl)-1,4-dithiane?
The InChIKey is MNGAWPOJPNONED-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10Br2S2/c7-1-5-3-10-6(2-8)4-9-5/h5-6H,1-4H2.
What are the key properties of 2,5-bis(bromomethyl)-1,4-dithiane?
2,5-bis(bromomethyl)-1,4-dithiane has a molecular weight of 306.09 g/mol, XLogP of 2.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(bromomethyl)-1,4-dithiane is sourced from PubChem (CID 67319976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).